C12H15BrF3N — CID 80679836
2-bromo-N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 80679836) has the molecular formula C12H15BrF3N and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-bromo-N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-bromo-N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 80679836 |
| Molecular Formula | C12H15BrF3N |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-bromo-N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCN(CCBr)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15BrF3N/c1-2-17(8-7-13)9-10-3-5-11(6-4-10)12(14,15)16/h3-6H,2,7-9H2,1H3 |
| InChIKey | LXVNITOESLOPRU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|