C13H17BrF3N — CID 143282104
N-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-N-ethylpropan-1-amine (PubChem CID 143282104) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is N-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-N-ethylpropan-1-amine.
| Compound Name | N-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 143282104 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-N-ethylpropan-1-amine |
| SMILES | CCCN(CC)Cc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H17BrF3N/c1-3-7-18(4-2)9-10-8-11(13(15,16)17)5-6-12(10)14/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | QRQVFXBGGXNFBY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |