C16H15BrF3NO — CID 72722956
2-[[[2-bromo-5-(trifluoromethyl)phenyl]methyl-methylamino]methyl]phenol (PubChem CID 72722956) has the molecular formula C16H15BrF3NO and a molecular weight of 374.20 g/mol. Its IUPAC name is 2-[[[2-bromo-5-(trifluoromethyl)phenyl]methyl-methylamino]methyl]phenol.
| Compound Name | 2-[[[2-bromo-5-(trifluoromethyl)phenyl]methyl-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 72722956 |
| Molecular Formula | C16H15BrF3NO |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-[[[2-bromo-5-(trifluoromethyl)phenyl]methyl-methylamino]methyl]phenol |
| SMILES | CN(Cc1ccccc1O)Cc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C16H15BrF3NO/c1-21(9-11-4-2-3-5-15(11)22)10-12-8-13(16(18,19)20)6-7-14(12)17/h2-8,22H,9-10H2,1H3 |
| InChIKey | VRPMAQKEZMTCTP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|