C10H13F2NO — CID 115624862
2-[[2,2-difluoroethyl(methyl)amino]methyl]phenol (PubChem CID 115624862) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(methyl)amino]methyl]phenol.
| Compound Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115624862 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[[2,2-difluoroethyl(methyl)amino]methyl]phenol |
| SMILES | CN(Cc1ccccc1O)CC(F)F |
| InChI | InChI=1S/C10H13F2NO/c1-13(7-10(11)12)6-8-4-2-3-5-9(8)14/h2-5,10,14H,6-7H2,1H3 |
| InChIKey | VWQLABLQJZYRKK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|