C12H18BrNO — CID 61416488
1-[(2-bromophenyl)methyl-methylamino]butan-2-ol (PubChem CID 61416488) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl-methylamino]butan-2-ol.
| Compound Name | 1-[(2-bromophenyl)methyl-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 61416488 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-[(2-bromophenyl)methyl-methylamino]butan-2-ol |
| SMILES | CCC(O)CN(C)Cc1ccccc1Br |
| InChI | InChI=1S/C12H18BrNO/c1-3-11(15)9-14(2)8-10-6-4-5-7-12(10)13/h4-7,11,15H,3,8-9H2,1-2H3 |
| InChIKey | VQUZVIDOEPABMY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |