C17H21BrN2O — CID 61416373
1-[4-(aminomethyl)phenyl]-2-[(2-bromophenyl)methyl-methylamino]ethanol (PubChem CID 61416373) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-2-[(2-bromophenyl)methyl-methylamino]ethanol.
| Compound Name | 1-[4-(aminomethyl)phenyl]-2-[(2-bromophenyl)methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 61416373 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-2-[(2-bromophenyl)methyl-methylamino]ethanol |
| SMILES | CN(Cc1ccccc1Br)CC(O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C17H21BrN2O/c1-20(11-15-4-2-3-5-16(15)18)12-17(21)14-8-6-13(10-19)7-9-14/h2-9,17,21H,10-12,19H2,1H3 |
| InChIKey | GKTUFDOTXNOVOZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |