C9H10Cl2F2N2 — CID 106993934
N-[(2,6-dichloro-3-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine (PubChem CID 106993934) has the molecular formula C9H10Cl2F2N2 and a molecular weight of 255.09 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine |
|---|---|
| PubChem CID | 106993934 |
| Molecular Formula | C9H10Cl2F2N2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-2,2-difluoro-N-methylethanamine |
| SMILES | CN(Cc1ccc(Cl)nc1Cl)CC(F)F |
| InChI | InChI=1S/C9H10Cl2F2N2/c1-15(5-8(12)13)4-6-2-3-7(10)14-9(6)11/h2-3,8H,4-5H2,1H3 |
| InChIKey | DFLJKVHGNALURQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|