C12H18Cl2N2S — CID 106993912
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine (PubChem CID 106993912) has the molecular formula C12H18Cl2N2S and a molecular weight of 293.26 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 106993912 |
| Molecular Formula | C12H18Cl2N2S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methyl-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)N(C)Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H18Cl2N2S/c1-4-10(8-17-3)16(2)7-9-5-6-11(13)15-12(9)14/h5-6,10H,4,7-8H2,1-3H3 |
| InChIKey | NWHOMQMRODUPEI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|