C10H14Cl2N2 — CID 106993491
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylpropan-1-amine (PubChem CID 106993491) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylpropan-1-amine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 106993491 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-methylpropan-1-amine |
| SMILES | CCCN(C)Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-3-6-14(2)7-8-4-5-9(11)13-10(8)12/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | GRHNJWYISUXUQJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|