C14H22Cl2N2O — CID 106993658
N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2-methoxyethyl)pentan-3-amine (PubChem CID 106993658) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2-methoxyethyl)pentan-3-amine.
| Compound Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2-methoxyethyl)pentan-3-amine |
|---|---|
| PubChem CID | 106993658 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[(2,6-dichloro-3-pyridinyl)methyl]-N-(2-methoxyethyl)pentan-3-amine |
| SMILES | CCC(CC)N(CCOC)Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O/c1-4-12(5-2)18(8-9-19-3)10-11-6-7-13(15)17-14(11)16/h6-7,12H,4-5,8-10H2,1-3H3 |
| InChIKey | GGBZYZCQTZKZPY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|