C11H15Cl2NO3 — CID 106994651
2,6-dichloro-3-[2-(2-methoxyethoxy)ethoxymethyl]pyridine (PubChem CID 106994651) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is 2,6-dichloro-3-[2-(2-methoxyethoxy)ethoxymethyl]pyridine.
| Compound Name | 2,6-dichloro-3-[2-(2-methoxyethoxy)ethoxymethyl]pyridine |
|---|---|
| PubChem CID | 106994651 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2,6-dichloro-3-[2-(2-methoxyethoxy)ethoxymethyl]pyridine |
| SMILES | COCCOCCOCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H15Cl2NO3/c1-15-4-5-16-6-7-17-8-9-2-3-10(12)14-11(9)13/h2-3H,4-8H2,1H3 |
| InChIKey | KAGKLRNNUPUFBJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|