C10H13Cl2NO2 — CID 106994598
2,6-dichloro-3-(1-methoxypropan-2-yloxymethyl)pyridine (PubChem CID 106994598) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 2,6-dichloro-3-(1-methoxypropan-2-yloxymethyl)pyridine.
| Compound Name | 2,6-dichloro-3-(1-methoxypropan-2-yloxymethyl)pyridine |
|---|---|
| PubChem CID | 106994598 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2,6-dichloro-3-(1-methoxypropan-2-yloxymethyl)pyridine |
| SMILES | COCC(C)OCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-7(5-14-2)15-6-8-3-4-9(11)13-10(8)12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PZAIAZWEIDYKAG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|