C12H6Cl4N2O3 — CID 106994564
2,6-dichloro-3-[(2,6-dichloro-4-nitrophenoxy)methyl]pyridine (PubChem CID 106994564) has the molecular formula C12H6Cl4N2O3 and a molecular weight of 368.00 g/mol. Its IUPAC name is 2,6-dichloro-3-[(2,6-dichloro-4-nitrophenoxy)methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(2,6-dichloro-4-nitrophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 106994564 |
| Molecular Formula | C12H6Cl4N2O3 |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 2,6-dichloro-3-[(2,6-dichloro-4-nitrophenoxy)methyl]pyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OCc2ccc(Cl)nc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H6Cl4N2O3/c13-8-3-7(18(19)20)4-9(14)11(8)21-5-6-1-2-10(15)17-12(6)16/h1-4H,5H2 |
| InChIKey | FCEKGGGOULLLBC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|