C13H10Cl2N2O4 — CID 106994569
2,6-dichloro-3-[(2-methoxy-4-nitrophenoxy)methyl]pyridine (PubChem CID 106994569) has the molecular formula C13H10Cl2N2O4 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2,6-dichloro-3-[(2-methoxy-4-nitrophenoxy)methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(2-methoxy-4-nitrophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 106994569 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2,6-dichloro-3-[(2-methoxy-4-nitrophenoxy)methyl]pyridine |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-20-11-6-9(17(18)19)3-4-10(11)21-7-8-2-5-12(14)16-13(8)15/h2-6H,7H2,1H3 |
| InChIKey | ZRKCLLRDLOPKOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|