C22H21NO6 — CID 142794424
1,2-bis[(2-methoxyphenyl)methoxy]-4-nitrobenzene (PubChem CID 142794424) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 1,2-bis[(2-methoxyphenyl)methoxy]-4-nitrobenzene.
| Compound Name | 1,2-bis[(2-methoxyphenyl)methoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 142794424 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1,2-bis[(2-methoxyphenyl)methoxy]-4-nitrobenzene |
| SMILES | COc1ccccc1COc1ccc([N+](=O)[O-])cc1OCc1ccccc1OC |
| InChI | InChI=1S/C22H21NO6/c1-26-19-9-5-3-7-16(19)14-28-21-12-11-18(23(24)25)13-22(21)29-15-17-8-4-6-10-20(17)27-2/h3-13H,14-15H2,1-2H3 |
| InChIKey | RGMDODRLUZXLNW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|