C10H8ClN3O4S — CID 80607055
2-chloro-5-[(2-methoxy-4-nitrophenoxy)methyl]-1,3,4-thiadiazole (PubChem CID 80607055) has the molecular formula C10H8ClN3O4S and a molecular weight of 301.71 g/mol. Its IUPAC name is 2-chloro-5-[(2-methoxy-4-nitrophenoxy)methyl]-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-[(2-methoxy-4-nitrophenoxy)methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80607055 |
| Molecular Formula | C10H8ClN3O4S |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-chloro-5-[(2-methoxy-4-nitrophenoxy)methyl]-1,3,4-thiadiazole |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCc1nnc(Cl)s1 |
| InChI | InChI=1S/C10H8ClN3O4S/c1-17-8-4-6(14(15)16)2-3-7(8)18-5-9-12-13-10(11)19-9/h2-4H,5H2,1H3 |
| InChIKey | LUPFRCMQAZNVHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|