C12H12ClN3O3S — CID 104785153
2-(3-chloropropyl)-5-(2-methoxy-4-nitrophenyl)-1,3,4-thiadiazole (PubChem CID 104785153) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(2-methoxy-4-nitrophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(2-methoxy-4-nitrophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 104785153 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-(3-chloropropyl)-5-(2-methoxy-4-nitrophenyl)-1,3,4-thiadiazole |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1nnc(CCCCl)s1 |
| InChI | InChI=1S/C12H12ClN3O3S/c1-19-10-7-8(16(17)18)4-5-9(10)12-15-14-11(20-12)3-2-6-13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | KJARRJVYJKZRIG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|