C11H10N2O4 — CID 90429374
5-(2-methoxy-4-nitrophenyl)-4-methyl-1,3-oxazole (PubChem CID 90429374) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-(2-methoxy-4-nitrophenyl)-4-methyl-1,3-oxazole.
| Compound Name | 5-(2-methoxy-4-nitrophenyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 90429374 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-(2-methoxy-4-nitrophenyl)-4-methyl-1,3-oxazole |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ocnc1C |
| InChI | InChI=1S/C11H10N2O4/c1-7-11(17-6-12-7)9-4-3-8(13(14)15)5-10(9)16-2/h3-6H,1-2H3 |
| InChIKey | OFJDUBHZMDGNPX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|