C10H8N2O4 — CID 163540013
2-(4-methyl-1,3-oxazol-5-yl)-5-nitrophenol (PubChem CID 163540013) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(4-methyl-1,3-oxazol-5-yl)-5-nitrophenol.
| Compound Name | 2-(4-methyl-1,3-oxazol-5-yl)-5-nitrophenol |
|---|---|
| PubChem CID | 163540013 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(4-methyl-1,3-oxazol-5-yl)-5-nitrophenol |
| SMILES | Cc1ncoc1-c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C10H8N2O4/c1-6-10(16-5-11-6)8-3-2-7(12(14)15)4-9(8)13/h2-5,13H,1H3 |
| InChIKey | FAHXRXDTOADWDD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|