C10H4ClN2NaO5 — CID 139851838
sodium 5-(2-chloro-4-nitrophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 139851838) has the molecular formula C10H4ClN2NaO5 and a molecular weight of 290.59 g/mol. Its IUPAC name is sodium 5-(2-chloro-4-nitrophenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | sodium 5-(2-chloro-4-nitrophenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 139851838 |
| Molecular Formula | C10H4ClN2NaO5 |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | sodium 5-(2-chloro-4-nitrophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | O=C([O-])c1ncoc1-c1ccc([N+](=O)[O-])cc1Cl.[Na+] |
| InChI | InChI=1S/C10H5ClN2O5.Na/c11-7-3-5(13(16)17)1-2-6(7)9-8(10(14)15)12-4-18-9;/h1-4H,(H,14,15);/q;+1/p-1 |
| InChIKey | RSAFQVKWPKPOBH-UHFFFAOYSA-M |
| XLogP | -1.73 |
| TPSA | 109.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|