C20H12Cl2N4O6 — CID 175916041
2,3-bis(2-chloro-4-nitrophenyl)benzene-1,4-dicarboxamide (PubChem CID 175916041) has the molecular formula C20H12Cl2N4O6 and a molecular weight of 475.24 g/mol. Its IUPAC name is 2,3-bis(2-chloro-4-nitrophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 2,3-bis(2-chloro-4-nitrophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175916041 |
| Molecular Formula | C20H12Cl2N4O6 |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 2,3-bis(2-chloro-4-nitrophenyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(-c2ccc([N+](=O)[O-])cc2Cl)c1-c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H12Cl2N4O6/c21-15-7-9(25(29)30)1-3-11(15)17-13(19(23)27)5-6-14(20(24)28)18(17)12-4-2-10(26(31)32)8-16(12)22/h1-8H,(H2,23,27)(H2,24,28) |
| InChIKey | CGWCGIMCVUUUSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|