C8H4ClN3O3 — CID 71563519
2-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 71563519) has the molecular formula C8H4ClN3O3 and a molecular weight of 225.59 g/mol. Its IUPAC name is 2-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71563519 |
| Molecular Formula | C8H4ClN3O3 |
| Molecular Weight | 225.59 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2nnco2)c1 |
| InChI | InChI=1S/C8H4ClN3O3/c9-7-2-1-5(12(13)14)3-6(7)8-11-10-4-15-8/h1-4H |
| InChIKey | MVYZQLOXXFVGGY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|