C9H6ClN5O2 — CID 6861205
(E)-1-(2-chloro-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6861205) has the molecular formula C9H6ClN5O2 and a molecular weight of 251.63 g/mol. Its IUPAC name is (E)-1-(2-chloro-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(2-chloro-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6861205 |
| Molecular Formula | C9H6ClN5O2 |
| Molecular Weight | 251.63 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | (E)-1-(2-chloro-5-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(/C=N/n2cnnc2)c1 |
| InChI | InChI=1S/C9H6ClN5O2/c10-9-2-1-8(15(16)17)3-7(9)4-13-14-5-11-12-6-14/h1-6H/b13-4+ |
| InChIKey | BXQQSGSTECUGAK-YIXHJXPBSA-N |
| XLogP | 1.72 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|