About 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol
5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol (PubChem CID 136759510) has the molecular formula C9H7N5O3
and a molecular weight of 233.19 g/mol. Its IUPAC name is 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol |
| PubChem CID | 136759510 |
| Molecular Formula | C9H7N5O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/C=N\n2cnnc2)c(O)c1 |
| InChI | InChI=1S/C9H7N5O3/c15-9-3-8(14(16)17)2-1-7(9)4-12-13-5-10-11-6-13/h1-6,15H/b12-4- |
| InChIKey | CXBZRLNVUXNGDA-QCDXTXTGSA-N |
| XLogP | 0.77 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol?
The IUPAC name of 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol (CID 136759510) is 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol.
What is the SMILES notation for 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol?
The canonical SMILES for 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol is O=[N+]([O-])c1ccc(/C=N\n2cnnc2)c(O)c1.
What is the InChIKey of 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol?
The InChIKey is CXBZRLNVUXNGDA-QCDXTXTGSA-N. The full InChI is InChI=1S/C9H7N5O3/c15-9-3-8(14(16)17)2-1-7(9)4-12-13-5-10-11-6-13/h1-6,15H/b12-4-.
What are the key properties of 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol?
5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol has a molecular weight of 233.19 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol is sourced from PubChem (CID 136759510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).