C13H9N7O2S — CID 21381196
(E)-1-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 21381196) has the molecular formula C13H9N7O2S and a molecular weight of 327.33 g/mol. Its IUPAC name is (E)-1-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 21381196 |
| Molecular Formula | C13H9N7O2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (E)-1-(5-nitro-2-pyrimidin-2-ylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(Sc2ncccn2)c(/C=N/n2cnnc2)c1 |
| InChI | InChI=1S/C13H9N7O2S/c21-20(22)11-2-3-12(23-13-14-4-1-5-15-13)10(6-11)7-18-19-8-16-17-9-19/h1-9H/b18-7+ |
| InChIKey | JEDJDGZLQFADGM-CNHKJKLMSA-N |
| XLogP | 2.01 |
| TPSA | 111.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|