C15H11N5O2S — CID 21381198
(E)-1-(5-nitro-2-phenylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 21381198) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is (E)-1-(5-nitro-2-phenylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(5-nitro-2-phenylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 21381198 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (E)-1-(5-nitro-2-phenylsulfanylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccccc2)c(/C=N/n2cnnc2)c1 |
| InChI | InChI=1S/C15H11N5O2S/c21-20(22)13-6-7-15(23-14-4-2-1-3-5-14)12(8-13)9-18-19-10-16-17-11-19/h1-11H/b18-9+ |
| InChIKey | BYIHQSPKEKDFMO-GIJQJNRQSA-N |
| XLogP | 3.22 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|