C10H7F2N5O3 — CID 2311769
1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 2311769) has the molecular formula C10H7F2N5O3 and a molecular weight of 283.19 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 2311769 |
| Molecular Formula | C10H7F2N5O3 |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(OC(F)F)c(C=Nn2cnnc2)c1 |
| InChI | InChI=1S/C10H7F2N5O3/c11-10(12)20-9-2-1-8(17(18)19)3-7(9)4-15-16-5-13-14-6-16/h1-6,10H |
| InChIKey | ZDZCAJINHKJYMZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|