C13H14N6O2 — CID 23884700
1-(5-nitro-2-pyrrolidin-1-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 23884700) has the molecular formula C13H14N6O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-(5-nitro-2-pyrrolidin-1-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-(5-nitro-2-pyrrolidin-1-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 23884700 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(5-nitro-2-pyrrolidin-1-ylphenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC2)c(C=Nn2cnnc2)c1 |
| InChI | InChI=1S/C13H14N6O2/c20-19(21)12-3-4-13(17-5-1-2-6-17)11(7-12)8-16-18-9-14-15-10-18/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | VYPGGVQFQKCFGX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|