C12H15N5O2S — CID 3604814
[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]thiourea (PubChem CID 3604814) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is [(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]thiourea.
| Compound Name | [(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3604814 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | [(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C12H15N5O2S/c13-12(20)15-14-8-9-7-10(17(18)19)3-4-11(9)16-5-1-2-6-16/h3-4,7-8H,1-2,5-6H2,(H3,13,15,20) |
| InChIKey | CVNGADVURLUDMA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|