C16H13F2N5O3 — CID 6298016
N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-methylbenzimidazol-2-amine (PubChem CID 6298016) has the molecular formula C16H13F2N5O3 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-methylbenzimidazol-2-amine.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 6298016 |
| Molecular Formula | C16H13F2N5O3 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-methylbenzimidazol-2-amine |
| SMILES | Cn1c(N/N=C\c2cc([N+](=O)[O-])ccc2OC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C16H13F2N5O3/c1-22-13-5-3-2-4-12(13)20-16(22)21-19-9-10-8-11(23(24)25)6-7-14(10)26-15(17)18/h2-9,15H,1H3,(H,20,21)/b19-9- |
| InChIKey | HOGNZVZTZCTNNN-OCKHKDLRSA-N |
| XLogP | 3.53 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|