C19H18F2N4O3 — CID 4840051
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide (PubChem CID 4840051) has the molecular formula C19H18F2N4O3 and a molecular weight of 388.37 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4840051 |
| Molecular Formula | C19H18F2N4O3 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
| SMILES | COc1cc(C=NNC(=O)Cc2nc3ccccc3n2C)ccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N4O3/c1-25-14-6-4-3-5-13(14)23-17(25)10-18(26)24-22-11-12-7-8-15(28-19(20)21)16(9-12)27-2/h3-9,11,19H,10H2,1-2H3,(H,24,26) |
| InChIKey | JPBTVHLMHZQCDM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|