C25H24N4O3 — CID 18228796
N-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide (PubChem CID 18228796) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide.
| Compound Name | N-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18228796 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-2-(1-methylbenzimidazol-2-yl)acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cc2nc3ccccc3n2C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O3/c1-29-21-11-7-6-10-20(21)27-24(29)15-25(30)28-26-16-19-12-13-22(31-2)23(14-19)32-17-18-8-4-3-5-9-18/h3-14,16H,15,17H2,1-2H3,(H,28,30)/b26-16+ |
| InChIKey | OJLOZZNGJHCPKG-WGOQTCKBSA-N |
| XLogP | 3.85 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|