C26H26N4O3 — CID 66851454
3-(1-benzylbenzimidazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]propanamide (PubChem CID 66851454) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-(1-benzylbenzimidazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(1-benzylbenzimidazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 66851454 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-(1-benzylbenzimidazol-2-yl)-N-[(3,4-dimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(C=NNC(=O)CCc2nc3ccccc3n2Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H26N4O3/c1-32-23-13-12-20(16-24(23)33-2)17-27-29-26(31)15-14-25-28-21-10-6-7-11-22(21)30(25)18-19-8-4-3-5-9-19/h3-13,16-17H,14-15,18H2,1-2H3,(H,29,31) |
| InChIKey | TVJYBDOOCYHTGV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|