C23H26N4O5 — CID 155927819
methyl 2-[2-methoxy-4-[(E)-[[2-(2-propan-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 155927819) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[(E)-[[2-(2-propan-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[(E)-[[2-(2-propan-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 155927819 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl 2-[2-methoxy-4-[(E)-[[2-(2-propan-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N/NC(=O)Cn2c(C(C)C)nc3ccccc32)cc1OC |
| InChI | InChI=1S/C23H26N4O5/c1-15(2)23-25-17-7-5-6-8-18(17)27(23)13-21(28)26-24-12-16-9-10-19(20(11-16)30-3)32-14-22(29)31-4/h5-12,15H,13-14H2,1-4H3,(H,26,28)/b24-12+ |
| InChIKey | QLKUXYFRFGQJJQ-WYMPLXKRSA-N |
| XLogP | 2.87 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|