C27H24Cl2N4O6 — CID 172676460
methyl 2-[5-[[[2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 172676460) has the molecular formula C27H24Cl2N4O6 and a molecular weight of 571.42 g/mol. Its IUPAC name is methyl 2-[5-[[[2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-[[[2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 172676460 |
| Molecular Formula | C27H24Cl2N4O6 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | methyl 2-[5-[[[2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(C=NNC(=O)Cn2c(-c3ccc(OC)cc3)nc3cc(Cl)c(Cl)cc32)ccc1OC |
| InChI | InChI=1S/C27H24Cl2N4O6/c1-36-18-7-5-17(6-8-18)27-31-21-11-19(28)20(29)12-22(21)33(27)14-25(34)32-30-13-16-4-9-23(37-2)24(10-16)39-15-26(35)38-3/h4-13H,14-15H2,1-3H3,(H,32,34) |
| InChIKey | PKPVYMSHIAUKLY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|