C23H18Cl2N4O3 — CID 172676394
2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 172676394) has the molecular formula C23H18Cl2N4O3 and a molecular weight of 469.33 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 172676394 |
| Molecular Formula | C23H18Cl2N4O3 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[5,6-dichloro-2-(4-methoxyphenyl)benzimidazol-1-yl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(-c2nc3cc(Cl)c(Cl)cc3n2CC(=O)NN=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H18Cl2N4O3/c1-32-17-8-4-15(5-9-17)23-27-20-10-18(24)19(25)11-21(20)29(23)13-22(31)28-26-12-14-2-6-16(30)7-3-14/h2-12,30H,13H2,1H3,(H,28,31) |
| InChIKey | AEWVXXKJDLDRRK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|