C32H26N4O4 — CID 171057667
4-[[[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 171057667) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is 4-[[[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 171057667 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4-[[[2-[2-(4-methoxyphenyl)-4,5-diphenylimidazol-1-yl]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2CC(=O)NN=Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O4/c1-40-27-18-16-25(17-19-27)31-34-29(23-8-4-2-5-9-23)30(24-10-6-3-7-11-24)36(31)21-28(37)35-33-20-22-12-14-26(15-13-22)32(38)39/h2-20H,21H2,1H3,(H,35,37)(H,38,39) |
| InChIKey | FYRVDGIRPJLTKE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|