C31H27N3O2 — CID 45023018
3-(2,3-diphenylindol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]propanamide (PubChem CID 45023018) has the molecular formula C31H27N3O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 3-(2,3-diphenylindol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(2,3-diphenylindol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 45023018 |
| Molecular Formula | C31H27N3O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-(2,3-diphenylindol-1-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCn2c(-c3ccccc3)c(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H27N3O2/c1-36-26-18-16-23(17-19-26)22-32-33-29(35)20-21-34-28-15-9-8-14-27(28)30(24-10-4-2-5-11-24)31(34)25-12-6-3-7-13-25/h2-19,22H,20-21H2,1H3,(H,33,35)/b32-22+ |
| InChIKey | PEICXAUJIIOOOL-WEMUVCOSSA-N |
| XLogP | 6.52 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|