C34H33N3O4 — CID 46299432
3-(5-methyl-2,3-diphenylindol-1-yl)-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 46299432) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is 3-(5-methyl-2,3-diphenylindol-1-yl)-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(5-methyl-2,3-diphenylindol-1-yl)-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 46299432 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 3-(5-methyl-2,3-diphenylindol-1-yl)-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NC(=O)CCn1c(-c2ccccc2)c(-c2ccccc2)c2cc(C)ccc21 |
| InChI | InChI=1S/C34H33N3O4/c1-23-15-16-28-27(19-23)33(24-11-7-5-8-12-24)34(25-13-9-6-10-14-25)37(28)18-17-32(38)36-35-22-26-20-30(40-3)31(41-4)21-29(26)39-2/h5-16,19-22H,17-18H2,1-4H3,(H,36,38)/b35-22+ |
| InChIKey | JBPOLONIBTYZTR-FADJLKOXSA-N |
| XLogP | 6.85 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|