C30H24BrN3O — CID 3111135
N-[(4-bromophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide (PubChem CID 3111135) has the molecular formula C30H24BrN3O and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide |
|---|---|
| PubChem CID | 3111135 |
| Molecular Formula | C30H24BrN3O |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-3-(2,3-diphenylindol-1-yl)propanamide |
| SMILES | O=C(CCn1c(-c2ccccc2)c(-c2ccccc2)c2ccccc21)NN=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H24BrN3O/c31-25-17-15-22(16-18-25)21-32-33-28(35)19-20-34-27-14-8-7-13-26(27)29(23-9-3-1-4-10-23)30(34)24-11-5-2-6-12-24/h1-18,21H,19-20H2,(H,33,35) |
| InChIKey | QZYWNEAFTBUKIB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|