C29H25N3O2 — CID 71952810
N-(furan-2-ylmethylideneamino)-3-(7-methyl-2,3-diphenylindol-1-yl)propanamide (PubChem CID 71952810) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(furan-2-ylmethylideneamino)-3-(7-methyl-2,3-diphenylindol-1-yl)propanamide.
| Compound Name | N-(furan-2-ylmethylideneamino)-3-(7-methyl-2,3-diphenylindol-1-yl)propanamide |
|---|---|
| PubChem CID | 71952810 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-(furan-2-ylmethylideneamino)-3-(7-methyl-2,3-diphenylindol-1-yl)propanamide |
| SMILES | Cc1cccc2c(-c3ccccc3)c(-c3ccccc3)n(CCC(=O)NN=Cc3ccco3)c12 |
| InChI | InChI=1S/C29H25N3O2/c1-21-10-8-16-25-27(22-11-4-2-5-12-22)29(23-13-6-3-7-14-23)32(28(21)25)18-17-26(33)31-30-20-24-15-9-19-34-24/h2-16,19-20H,17-18H2,1H3,(H,31,33) |
| InChIKey | XSTSZOCCBAJRGR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|