C13H16N4O4 — CID 9213261
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]propanamide (PubChem CID 9213261) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 9213261 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]propanamide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)N/N=C\c2ccco2)C1=O |
| InChI | InChI=1S/C13H16N4O4/c1-13(2)11(19)17(12(20)15-13)6-5-10(18)16-14-8-9-4-3-7-21-9/h3-4,7-8H,5-6H2,1-2H3,(H,15,20)(H,16,18)/b14-8- |
| InChIKey | UVXPRTYFZHZBCL-ZSOIEALJSA-N |
| XLogP | 0.45 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|