C18H22N4O6 — CID 9214062
[4-[(Z)-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylhydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 9214062) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is [4-[(Z)-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylhydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylhydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 9214062 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [4-[(Z)-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoylhydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\NC(=O)CCN2C(=O)NC(C)(C)C2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C18H22N4O6/c1-11(23)28-13-6-5-12(9-14(13)27-4)10-19-21-15(24)7-8-22-16(25)18(2,3)20-17(22)26/h5-6,9-10H,7-8H2,1-4H3,(H,20,26)(H,21,24)/b19-10- |
| InChIKey | HDKSXYWOHIGLIU-GRSHGNNSSA-N |
| XLogP | 0.79 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|