C16H19ClN4O5 — CID 135577184
N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 135577184) has the molecular formula C16H19ClN4O5 and a molecular weight of 382.80 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 135577184 |
| Molecular Formula | C16H19ClN4O5 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | COc1cc(/C=N/NC(=O)CCN2C(=O)NC(C)(C)C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C16H19ClN4O5/c1-16(2)14(24)21(15(25)19-16)5-4-12(22)20-18-8-9-6-10(17)13(23)11(7-9)26-3/h6-8,23H,4-5H2,1-3H3,(H,19,25)(H,20,22)/b18-8+ |
| InChIKey | PHWVXUWXIXTFEC-QGMBQPNBSA-N |
| XLogP | 1.22 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|