C16H18Cl2N4O3 — CID 9213512
N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 9213512) has the molecular formula C16H18Cl2N4O3 and a molecular weight of 385.25 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 9213512 |
| Molecular Formula | C16H18Cl2N4O3 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | C/C(=N/NC(=O)CCN1C(=O)NC(C)(C)C1=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H18Cl2N4O3/c1-9(11-8-10(17)4-5-12(11)18)20-21-13(23)6-7-22-14(24)16(2,3)19-15(22)25/h4-5,8H,6-7H2,1-3H3,(H,19,25)(H,21,23)/b20-9- |
| InChIKey | GBUKHZDBAPROEX-UKWGHVSLSA-N |
| XLogP | 2.55 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|