C16H13Cl2FN2O — CID 7428850
N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 7428850) has the molecular formula C16H13Cl2FN2O and a molecular weight of 339.20 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7428850 |
| Molecular Formula | C16H13Cl2FN2O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | C/C(=N/NC(=O)Cc1ccc(F)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O/c1-10(14-9-12(17)4-7-15(14)18)20-21-16(22)8-11-2-5-13(19)6-3-11/h2-7,9H,8H2,1H3,(H,21,22)/b20-10- |
| InChIKey | FBQOSCBVVAZDJE-JMIUGGIZSA-N |
| XLogP | 4.22 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|