C14H13Cl2N3OS — CID 9029099
N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9029099) has the molecular formula C14H13Cl2N3OS and a molecular weight of 342.25 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9029099 |
| Molecular Formula | C14H13Cl2N3OS |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-[(Z)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | C/C(=N/NC(=O)Cc1nc(C)cs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3OS/c1-8-7-21-14(17-8)6-13(20)19-18-9(2)11-5-10(15)3-4-12(11)16/h3-5,7H,6H2,1-2H3,(H,19,20)/b18-9- |
| InChIKey | YWGQNRVOXQHDRU-NVMNQCDNSA-N |
| XLogP | 3.84 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|