C17H22N4O3S2 — CID 9030044
2-(4-methyl-1,3-thiazol-2-yl)-N-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]acetamide (PubChem CID 9030044) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9030044 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-[(Z)-1-[4-(propylsulfamoyl)phenyl]ethylideneamino]acetamide |
| SMILES | CCCNS(=O)(=O)c1ccc(/C(C)=N\NC(=O)Cc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-4-9-18-26(23,24)15-7-5-14(6-8-15)13(3)20-21-16(22)10-17-19-12(2)11-25-17/h5-8,11,18H,4,9-10H2,1-3H3,(H,21,22)/b20-13- |
| InChIKey | QRFFVNXMODRVNO-MOSHPQCFSA-N |
| XLogP | 2.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|