C18H21N3O4S — CID 9012894
4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid (PubChem CID 9012894) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 9012894 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(/C(C)=N\Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-3-12-19-26(24,25)17-10-6-14(7-11-17)13(2)20-21-16-8-4-15(5-9-16)18(22)23/h4-11,19,21H,3,12H2,1-2H3,(H,22,23)/b20-13- |
| InChIKey | QGLQBTMKYGPHAN-MOSHPQCFSA-N |
| XLogP | 2.91 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|