C11H13Cl3N2O3S — CID 17320825
2,2,2-trichloro-N-[4-(propylsulfamoyl)phenyl]acetamide (PubChem CID 17320825) has the molecular formula C11H13Cl3N2O3S and a molecular weight of 359.66 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(propylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(propylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17320825 |
| Molecular Formula | C11H13Cl3N2O3S |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(propylsulfamoyl)phenyl]acetamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H13Cl3N2O3S/c1-2-7-15-20(18,19)9-5-3-8(4-6-9)16-10(17)11(12,13)14/h3-6,15H,2,7H2,1H3,(H,16,17) |
| InChIKey | UJBGGPYKOVRMCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|